* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (6,7-DIHYDRO-4H-PYRAZOLO[5,1-C][1,4]OXAZIN-2-YL)METHANOL |
CAS: | 623565-58-2 |
English Synonyms: | (6,7-DIHYDRO-4H-PYRAZOLO[5,1-C][1,4]OXAZIN-2-YL)METHANOL ; 6,7-DIHYDRO-4H-PYRAZOLO[5,1-C][1,4]OXAZINE-2-METHANOL |
MDL Number.: | MFCD16620641 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c2n(nc1CO)CCOC2 |
InChi: | InChI=1S/C7H10N2O2/c10-4-6-3-7-5-11-2-1-9(7)8-6/h3,10H,1-2,4-5H2 |
InChiKey: | InChIKey=BHXIVJNUCBWSFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.