* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3-BENZOXAZOL-7-OL |
| CAS: | 94242-04-3 |
| English Synonyms: | 1,3-BENZOXAZOL-7-OL ; BENZOOXAZOL-7-OL |
| MDL Number.: | MFCD16657804 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)O)ocn2 |
| InChi: | InChI=1S/C7H5NO2/c9-6-3-1-2-5-7(6)10-4-8-5/h1-4,9H |
| InChiKey: | InChIKey=SOQJEEOOJYUDGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.