* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(7-AMINO-1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ETHAN-1-OL |
English Synonyms: | 2-(7-AMINO-1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ETHAN-1-OL |
MDL Number.: | MFCD16751894 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1N)N(CCC2)CCO |
InChi: | InChI=1S/C11H16N2O/c12-10-4-3-9-2-1-5-13(6-7-14)11(9)8-10/h3-4,8,14H,1-2,5-7,12H2 |
InChiKey: | InChIKey=BGMHPQYMGLHIKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.