* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-FLUORO-1-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]BENZENE-1,2-DIAMINE |
English Synonyms: | 5-FLUORO-1-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]BENZENE-1,2-DIAMINE |
MDL Number.: | MFCD16754282 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cnnc1CNc2cc(ccc2N)F |
InChi: | InChI=1S/C10H12FN5/c1-16-6-14-15-10(16)5-13-9-4-7(11)2-3-8(9)12/h2-4,6,13H,5,12H2,1H3 |
InChiKey: | InChIKey=POGRJRDNGYDNGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.