* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-N-(PROP-2-EN-1-YL)-6-PROPOXYPYRIDINE-2,5-DIAMINE |
English Synonyms: | 2-N-(PROP-2-EN-1-YL)-6-PROPOXYPYRIDINE-2,5-DIAMINE |
MDL Number.: | MFCD16780460 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCCOc1c(ccc(n1)NCC=C)N |
InChi: | InChI=1S/C11H17N3O/c1-3-7-13-10-6-5-9(12)11(14-10)15-8-4-2/h3,5-6H,1,4,7-8,12H2,2H3,(H,13,14) |
InChiKey: | InChIKey=XAXIZSOIUKHBEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.