* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(THIOPHEN-3-YL)-9-OXA-6-AZASPIRO[4.5]DECANE |
English Synonyms: | 8-(THIOPHEN-3-YL)-9-OXA-6-AZASPIRO[4.5]DECANE |
MDL Number.: | MFCD16784857 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cscc1C2CNC3(CCCC3)CO2 |
InChi: | InChI=1S/C12H17NOS/c1-2-5-12(4-1)9-14-11(7-13-12)10-3-6-15-8-10/h3,6,8,11,13H,1-2,4-5,7,9H2 |
InChiKey: | InChIKey=ZDKXNCPIJITMFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.