* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL[1-(PYRIDIN-4-YL)PENT-4-YN-2-YL]AMINE |
English Synonyms: | PROPYL[1-(PYRIDIN-4-YL)PENT-4-YN-2-YL]AMINE |
MDL Number.: | MFCD16786464 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC(CC#C)Cc1ccncc1 |
InChi: | InChI=1S/C13H18N2/c1-3-5-13(15-8-4-2)11-12-6-9-14-10-7-12/h1,6-7,9-10,13,15H,4-5,8,11H2,2H3 |
InChiKey: | InChIKey=DLVFHHVFGIFVJA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.