* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2-ETHOXYETHOXY)-3,4-DIFLUOROANILINE |
| English Synonyms: | 2-(2-ETHOXYETHOXY)-3,4-DIFLUOROANILINE |
| MDL Number.: | MFCD16787320 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCOCCOc1c(ccc(c1F)F)N |
| InChi: | InChI=1S/C10H13F2NO2/c1-2-14-5-6-15-10-8(13)4-3-7(11)9(10)12/h3-4H,2,5-6,13H2,1H3 |
| InChiKey: | InChIKey=PULGLWIHZGQILA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.