* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(6-AMINO-2,3-DIFLUOROPHENOXY)ETHAN-1-OL |
English Synonyms: | 2-(6-AMINO-2,3-DIFLUOROPHENOXY)ETHAN-1-OL |
MDL Number.: | MFCD16787328 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(c(c(c1N)OCCO)F)F |
InChi: | InChI=1S/C8H9F2NO2/c9-5-1-2-6(11)8(7(5)10)13-4-3-12/h1-2,12H,3-4,11H2 |
InChiKey: | InChIKey=UCKOCVUVLMQSNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.