* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-METHYL-1-(1,3-THIAZOL-2-YL)PIPERIDIN-3-AMINE |
| English Synonyms: | N-METHYL-1-(1,3-THIAZOL-2-YL)PIPERIDIN-3-AMINE |
| MDL Number.: | MFCD16789062 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CNC1CCCN(C1)c2nccs2 |
| InChi: | InChI=1S/C9H15N3S/c1-10-8-3-2-5-12(7-8)9-11-4-6-13-9/h4,6,8,10H,2-3,5,7H2,1H3 |
| InChiKey: | InChIKey=CZEDUHZSOBNVJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.