* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2-[(PROP-2-YN-1-YL)AMINO]ETHYL)-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
English Synonyms: | 2-(2-[(PROP-2-YN-1-YL)AMINO]ETHYL)-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
MDL Number.: | MFCD16799453 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C#CCNCCn1c(=O)n2ccccc2n1 |
InChi: | InChI=1S/C11H12N4O/c1-2-6-12-7-9-15-11(16)14-8-4-3-5-10(14)13-15/h1,3-5,8,12H,6-7,9H2 |
InChiKey: | InChIKey=SYQTZJULTAJWHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.