* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-1,2,3,4-TETRAHYDROPYRIMIDINE-2,4-DIONE |
English Synonyms: | 1-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-1,2,3,4-TETRAHYDROPYRIMIDINE-2,4-DIONE |
MDL Number.: | MFCD16799534 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C=CCNCCn1ccc(=O)[nH]c1=O |
InChi: | InChI=1S/C9H13N3O2/c1-2-4-10-5-7-12-6-3-8(13)11-9(12)14/h2-3,6,10H,1,4-5,7H2,(H,11,13,14) |
InChiKey: | InChIKey=FBIZJAJIEIZJRO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.