* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349113 |
English Synonyms: | UKRORGSYN-BB BBV-34349113 |
MDL Number.: | MFCD16800171 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)NCCn1nc(nn1)c2ccco2 |
InChi: | InChI=1S/C10H15N5O/c1-8(2)11-5-6-15-13-10(12-14-15)9-4-3-7-16-9/h3-4,7-8,11H,5-6H2,1-2H3 |
InChiKey: | InChIKey=WIDBDICCNVFREX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.