* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34350177 |
English Synonyms: | UKRORGSYN-BB BBV-34350177 |
MDL Number.: | MFCD16801220 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C=CCOCCNCc1cc(cs1)Br |
InChi: | InChI=1S/C10H14BrNOS/c1-2-4-13-5-3-12-7-10-6-9(11)8-14-10/h2,6,8,12H,1,3-5,7H2 |
InChiKey: | InChIKey=FSDVQFVFCYMFOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.