* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352593 |
English Synonyms: | UKRORGSYN-BB BBV-34352593 |
MDL Number.: | MFCD16803569 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)CCNCC(C)Sc1nccn1C |
InChi: | InChI=1S/C12H23N3S/c1-10(2)5-6-13-9-11(3)16-12-14-7-8-15(12)4/h7-8,10-11,13H,5-6,9H2,1-4H3 |
InChiKey: | InChIKey=MJQVRQAQUQLQJB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.