* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354546 |
English Synonyms: | UKRORGSYN-BB BBV-34354546 |
MDL Number.: | MFCD16805511 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(c1cccs1)NCCSc2nccs2 |
InChi: | InChI=1S/C11H14N2S3/c1-9(10-3-2-6-14-10)12-4-7-15-11-13-5-8-16-11/h2-3,5-6,8-9,12H,4,7H2,1H3 |
InChiKey: | InChIKey=HREYKUUSQUVNNF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.