* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10871685 |
| English Synonyms: | SELENA SEL10871685 |
| MDL Number.: | MFCD16832875 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c(c(sc1Cl)Cl)S(=O)(=O)NCCCC#N |
| InChi: | InChI=1S/C8H8Cl2N2O2S2/c9-7-5-6(8(10)15-7)16(13,14)12-4-2-1-3-11/h5,12H,1-2,4H2 |
| InChiKey: | InChIKey=PJRCYSSYQGUWPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.