* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028226 |
English Synonyms: | ABAMACHEM ABA-6028226 |
MDL Number.: | MFCD16835209 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCC(CC#N)NS(=O)(=O)c1cn[nH]c1C |
InChi: | InChI=1S/C9H14N4O2S/c1-3-8(4-5-10)13-16(14,15)9-6-11-12-7(9)2/h6,8,13H,3-4H2,1-2H3,(H,11,12) |
InChiKey: | InChIKey=SPRITUQBLFCRSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.