* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-BROMO-3H-IMIDAZO[4,5-B]PYRIDIN-2-AMINE |
| English Synonyms: | 6-BROMO-3H-IMIDAZO[4,5-B]PYRIDIN-2-AMINE ; ABBYPHARMA AP-30-2443 |
| MDL Number.: | MFCD16845543 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1c(cnc2c1nc([nH]2)N)Br |
| InChi: | InChI=1S/C6H5BrN4/c7-3-1-4-5(9-2-3)11-6(8)10-4/h1-2H,(H3,8,9,10,11) |
| InChiKey: | InChIKey=GORQWQZKRKREQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.