* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-N-(2-METHYLBUTYL)-2,1,3-BENZOXADIAZOLE-4,7-DIAMINE |
English Synonyms: | 4-N-(2-METHYLBUTYL)-2,1,3-BENZOXADIAZOLE-4,7-DIAMINE |
MDL Number.: | MFCD16848798 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCC(C)CNc1ccc(c2c1non2)N |
InChi: | InChI=1S/C11H16N4O/c1-3-7(2)6-13-9-5-4-8(12)10-11(9)15-16-14-10/h4-5,7,13H,3,6,12H2,1-2H3 |
InChiKey: | InChIKey=FWBFMJSXYPDOQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.