* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[2-AMINO-2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]PHENOL |
English Synonyms: | 4-[2-AMINO-2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]PHENOL |
MDL Number.: | MFCD16850753 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cnnc1C(Cc2ccc(cc2)O)N |
InChi: | InChI=1S/C11H14N4O/c1-15-7-13-14-11(15)10(12)6-8-2-4-9(16)5-3-8/h2-5,7,10,16H,6,12H2,1H3 |
InChiKey: | InChIKey=DAFJTAWLLRUGJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.