* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)CYCLOHEX-3-ENE-1-CARBOXYLIC ACID |
| English Synonyms: | 6-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)CYCLOHEX-3-ENE-1-CARBOXYLIC ACID |
| MDL Number.: | MFCD16850796 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1C2CC=CCC2C(=O)O |
| InChi: | InChI=1S/C10H13N3O2/c1-13-6-11-12-9(13)7-4-2-3-5-8(7)10(14)15/h2-3,6-8H,4-5H2,1H3,(H,14,15) |
| InChiKey: | InChIKey=LYOXGVVLFRPTKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.