* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)-1H-PYRAZOL-5-AMINE |
English Synonyms: | 4-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)-1H-PYRAZOL-5-AMINE |
MDL Number.: | MFCD16850808 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCn1cnnc1c2cn[nH]c2N |
InChi: | InChI=1S/C7H10N6/c1-2-13-4-10-12-7(13)5-3-9-11-6(5)8/h3-4H,2H2,1H3,(H3,8,9,11) |
InChiKey: | InChIKey=DOTUBCOBZPFHMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.