* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-4-YL)-4H-1,2,4-TRIAZOLE |
English Synonyms: | 4-ETHYL-3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-4-YL)-4H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16850822 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1cnnc1C2c3ccsc3CCN2 |
InChi: | InChI=1S/C11H14N4S/c1-2-15-7-13-14-11(15)10-8-4-6-16-9(8)3-5-12-10/h4,6-7,10,12H,2-3,5H2,1H3 |
InChiKey: | InChIKey=FPLGHCMZHBFVCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.