* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1,3-THIAZOL-2-AMINE |
English Synonyms: | 4-[(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1,3-THIAZOL-2-AMINE |
MDL Number.: | MFCD16850837 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnnc1Cc2csc(n2)N |
InChi: | InChI=1S/C8H11N5S/c1-2-13-5-10-12-7(13)3-6-4-14-8(9)11-6/h4-5H,2-3H2,1H3,(H2,9,11) |
InChiKey: | InChIKey=YJIJDEODIGYXIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.