* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-3-(4-METHOXYPYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
English Synonyms: | 4-ETHYL-3-(4-METHOXYPYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16850859 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnnc1C2CC(CN2)OC |
InChi: | InChI=1S/C9H16N4O/c1-3-13-6-11-12-9(13)8-4-7(14-2)5-10-8/h6-8,10H,3-5H2,1-2H3 |
InChiKey: | InChIKey=CVDPRZGKWVLIQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.