* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PIPERIDINE |
English Synonyms: | 4-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PIPERIDINE |
MDL Number.: | MFCD16851575 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1nc(n(n1)C)C2CCNCC2 |
InChi: | InChI=1S/C9H16N4/c1-7-11-9(13(2)12-7)8-3-5-10-6-4-8/h8,10H,3-6H2,1-2H3 |
InChiKey: | InChIKey=ICLLREJPCQZMEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.