* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]CYCLOHEXAN-1-AMINE |
English Synonyms: | 4-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]CYCLOHEXAN-1-AMINE |
MDL Number.: | MFCD16852243 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCCn1cnnc1C2CCC(CC2)N |
InChi: | InChI=1S/C11H20N4O/c1-16-7-6-15-8-13-14-11(15)9-2-4-10(12)5-3-9/h8-10H,2-7,12H2,1H3 |
InChiKey: | InChIKey=ZUBKNUXVKLCGID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.