* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-([4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]METHYL)-1,3-THIAZOL-2-AMINE |
English Synonyms: | 4-([4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]METHYL)-1,3-THIAZOL-2-AMINE |
MDL Number.: | MFCD16852257 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COCCn1cnnc1Cc2csc(n2)N |
InChi: | InChI=1S/C9H13N5OS/c1-15-3-2-14-6-11-13-8(14)4-7-5-16-9(10)12-7/h5-6H,2-4H2,1H3,(H2,10,12) |
InChiKey: | InChIKey=WNIAERBMEHTSKG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.