* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL(([4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
| English Synonyms: | ETHYL(([4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
| MDL Number.: | MFCD16852350 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCNCc1nncn1CC(C)C |
| InChi: | InChI=1S/C9H18N4/c1-4-10-5-9-12-11-7-13(9)6-8(2)3/h7-8,10H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=BWEWGPUDXQWEQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.