* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-CYCLOPENTYL-4H-1,2,4-TRIAZOL-3-AMINE |
English Synonyms: | 4-CYCLOPENTYL-4H-1,2,4-TRIAZOL-3-AMINE |
MDL Number.: | MFCD16852359 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1nnc(n1C2CCCC2)N |
InChi: | InChI=1S/C7H12N4/c8-7-10-9-5-11(7)6-3-1-2-4-6/h5-6H,1-4H2,(H2,8,10) |
InChiKey: | InChIKey=REOCEMWHDRDZGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.