* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-FLUORO-4-(PROP-2-YN-1-YLOXY)BENZOIC ACID |
| English Synonyms: | 3-FLUORO-4-(PROP-2-YN-1-YLOXY)BENZOIC ACID |
| MDL Number.: | MFCD16852820 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C#CCOc1ccc(cc1F)C(=O)O |
| InChi: | InChI=1S/C10H7FO3/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h1,3-4,6H,5H2,(H,12,13) |
| InChiKey: | InChIKey=BBFLRTCZRHQCQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.