* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(BUT-2-EN-1-YLOXY)-3-FLUOROBENZOIC ACID |
English Synonyms: | 4-(BUT-2-EN-1-YLOXY)-3-FLUOROBENZOIC ACID |
MDL Number.: | MFCD16852920 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C/C=C/COc1ccc(cc1F)C(=O)O |
InChi: | InChI=1S/C11H11FO3/c1-2-3-6-15-10-5-4-8(11(13)14)7-9(10)12/h2-5,7H,6H2,1H3,(H,13,14)/b3-2+ |
InChiKey: | InChIKey=WDDKRVSCWQTUCA-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.