* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PROPAN-2-YL)-1-PROPYLCYCLOHEXAN-1-OL |
English Synonyms: | 4-(PROPAN-2-YL)-1-PROPYLCYCLOHEXAN-1-OL |
MDL Number.: | MFCD16853297 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCC1(CCC(CC1)C(C)C)O |
InChi: | InChI=1S/C12H24O/c1-4-7-12(13)8-5-11(6-9-12)10(2)3/h10-11,13H,4-9H2,1-3H3 |
InChiKey: | InChIKey=MNGHYCOBZKVOIO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.