* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CYCLOBUTYL-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
English Synonyms: | 8-CYCLOBUTYL-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
MDL Number.: | MFCD16855238 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC(C1)N2C3CCC2CC(=O)C3 |
InChi: | InChI=1S/C11H17NO/c13-11-6-9-4-5-10(7-11)12(9)8-2-1-3-8/h8-10H,1-7H2 |
InChiKey: | InChIKey=OUZFGXQXWAJAAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.