* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-1-PHENYLHEXAN-2-AMINE |
English Synonyms: | 4-ETHYL-1-PHENYLHEXAN-2-AMINE |
MDL Number.: | MFCD16858356 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(CC)CC(Cc1ccccc1)N |
InChi: | InChI=1S/C14H23N/c1-3-12(4-2)10-14(15)11-13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11,15H2,1-2H3 |
InChiKey: | InChIKey=DYRGLSRWKUWPON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.