* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL(([5-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
English Synonyms: | PROPYL(([5-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
MDL Number.: | MFCD16859270 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCCNCc1nc([nH]n1)c2cccs2 |
InChi: | InChI=1S/C10H14N4S/c1-2-5-11-7-9-12-10(14-13-9)8-4-3-6-15-8/h3-4,6,11H,2,5,7H2,1H3,(H,12,13,14) |
InChiKey: | InChIKey=HSQBJCVHJYVMCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.