* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1-CHLOROPROPYL)-1,3,5-TRIMETHYL-1H-PYRAZOLE |
English Synonyms: | 4-(1-CHLOROPROPYL)-1,3,5-TRIMETHYL-1H-PYRAZOLE |
MDL Number.: | MFCD16862354 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(c1c(nn(c1C)C)C)Cl |
InChi: | InChI=1S/C9H15ClN2/c1-5-8(10)9-6(2)11-12(4)7(9)3/h8H,5H2,1-4H3 |
InChiKey: | InChIKey=ODZZGGFBNQVAGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.