* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6008883 |
English Synonyms: | ABAMACHEM ABA-6008883 |
MDL Number.: | MFCD16865838 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cncnc1CNC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C9H13N3O2S/c13-15(14)4-2-9(6-15)11-5-8-1-3-10-7-12-8/h1,3,7,9,11H,2,4-6H2 |
InChiKey: | InChIKey=PSKNYWUAOLJDPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.