* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL((1-[2-(PIPERIDIN-1-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| English Synonyms: | METHYL((1-[2-(PIPERIDIN-1-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| MDL Number.: | MFCD16870273 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(c1cnc(s1)N2CCCCC2)NC |
| InChi: | InChI=1S/C11H19N3S/c1-9(12-2)10-8-13-11(15-10)14-6-4-3-5-7-14/h8-9,12H,3-7H2,1-2H3 |
| InChiKey: | InChIKey=NMOZHYVYXFJMDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.