* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6185383 |
English Synonyms: | ABAMACHEM ABA-6185383 |
MDL Number.: | MFCD16871437 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN1C2CCC1c3cc(nnc3C2)N |
InChi: | InChI=1S/C10H14N4/c1-14-6-2-3-9(14)7-5-10(11)13-12-8(7)4-6/h5-6,9H,2-4H2,1H3,(H2,11,13) |
InChiKey: | InChIKey=RZQZETNXQFFGJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.