* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-CHLORO-4B,12A-DIHYDROXY-4B,5,12,12A-TETRAHYDRO-6,11A,12-TRIAZA-INDENO[1,2-B]ANTHRACENE-11,13-DIONE |
| English Synonyms: | 9-CHLORO-4B,12A-DIHYDROXY-4B,5,12,12A-TETRAHYDRO-6,11A,12-TRIAZA-INDENO[1,2-B]ANTHRACENE-11,13-DIONE ; ZERENEX E/1070050 |
| MDL Number.: | MFCD16872352 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)C(=O)C3(C2(Cc4nc5ccc(cc5c(=O)n4N3)Cl)O)O |
| InChi: | InChI=1S/C18H12ClN3O4/c19-9-5-6-13-11(7-9)16(24)22-14(20-13)8-17(25)12-4-2-1-3-10(12)15(23)18(17,26)21-22/h1-7,21,25-26H,8H2 |
| InChiKey: | InChIKey=MGKWVSMVFRLLQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.