* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-1(2H)-ISOQUINOLINONE |
CAS: | 129959-09-7 |
English Synonyms: | 8-METHOXY-1(2H)-ISOQUINOLINONE |
MDL Number.: | MFCD16876280 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1cccc2c1c(=O)[nH]cc2 |
InChi: | InChI=1S/C10H9NO2/c1-13-8-4-2-3-7-5-6-11-10(12)9(7)8/h2-6H,1H3,(H,11,12) |
InChiKey: | InChIKey=NHQVJRHYYKAZIP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.