* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FERROUS GLYCINE |
English Synonyms: | FERROUS GLYCINE |
MDL Number.: | MFCD16877200 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C(C(=O)[O-])N.C(C(=O)[O-])N.[Fe+2] |
InChi: | InChI=1S/2C2H5NO2.Fe/c2*3-1-2(4)5;/h2*1,3H2,(H,4,5);/q;;+2/p-2 |
InChiKey: | InChIKey=GIPOFCXYHMWROH-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.