* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[2,1-B]THIAZOLE-5,6-DIAMINE |
CAS: | 863203-49-0 |
English Synonyms: | IMIDAZO[2,1-B]THIAZOLE-5,6-DIAMINE |
MDL Number.: | MFCD16878527 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1csc2n1c(c(n2)N)N |
InChi: | InChI=1S/C5H6N4S/c6-3-4(7)9-1-2-10-5(9)8-3/h1-2H,6-7H2 |
InChiKey: | InChIKey=WBESVFNRHDMHBS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.