* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-CARBAZOLE-3,4-DIAMINE |
CAS: | 866359-92-4 |
English Synonyms: | 9H-CARBAZOLE-3,4-DIAMINE |
MDL Number.: | MFCD16878601 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c3c([nH]2)ccc(c3N)N |
InChi: | InChI=1S/C12H11N3/c13-8-5-6-10-11(12(8)14)7-3-1-2-4-9(7)15-10/h1-6,15H,13-14H2 |
InChiKey: | InChIKey=NKHRFWGIVAKAMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.