* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALLICHEM 41833 |
English Synonyms: | ALLICHEM 41833 |
MDL Number.: | MFCD16987851 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)NCC(CN(c2ccc(cc2)Br)c3ccc(cc3)Br)O |
InChi: | InChI=1S/C21H20Br2N2O/c22-16-6-10-19(11-7-16)25(20-12-8-17(23)9-13-20)15-21(26)14-24-18-4-2-1-3-5-18/h1-13,21,24,26H,14-15H2 |
InChiKey: | InChIKey=HKZKZDKXMBPBAC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.