* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1348 |
CAS: | 1023812-15-8 |
English Synonyms: | ABBYPHARMA AP-10-1348 |
MDL Number.: | MFCD16988022 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | OC(=O)C1=C(Br)C=NC(=S)N1 |
InChi: | InChI=1S/C5H3BrN2O2S/c6-2-1-7-5(11)8-3(2)4(9)10/h1H,(H,9,10)(H,7,8,11) |
InChiKey: | InChIKey=IHNODPCVAKCZOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.