* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1407 |
English Synonyms: | ABBYPHARMA AP-10-1407 |
MDL Number.: | MFCD16988060 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2cc(nc(n2)c3ccncc3)C(=O)O |
InChi: | InChI=1S/C16H11N3O2/c20-16(21)14-10-13(11-4-2-1-3-5-11)18-15(19-14)12-6-8-17-9-7-12/h1-10H,(H,20,21) |
InChiKey: | InChIKey=WZHABJQDLRCADU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.