* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1501 |
CAS: | 65407-49-0 |
English Synonyms: | ABBYPHARMA AP-10-1501 |
MDL Number.: | MFCD16988097 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC1=NC=C(C(O)=O)C(=O)N1 |
InChi: | InChI=1S/C6H6N2O4/c1-12-6-7-2-3(5(10)11)4(9)8-6/h2H,1H3,(H,10,11)(H,7,8,9) |
InChiKey: | InChIKey=YTKYPRAFSMQSBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.